Products 81264-57-5
CAS 81264-57-5 appears in our catalog under these names: (-)-MDO-NPA HCl, (-)-MDO-NPA. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(12R)-13-propyl-4,6-dioxa-13-azapentacyclo[10.7.1.02,10.03,7.016,20]icosa-1(19),2(10),3(7),8,16(20),17-hexaene (CAS 81264-57-5) is a chemical compound with the molecular formula C20H21NO2 and a molecular weight of 307.4 g/mol. IUPAC name: (12R)-13-propyl-4,6-dioxa-13-azapentacyclo[10.7.1.02,10.03,7.016,20]icosa-1(19),2(10),3(7),8,16(20),17-hexaene. InChIKey: YSONYEIWWIFWEV-MRXNPFEDSA-N.
| Molecular formula | C20H21NO2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (12R)-13-propyl-4,6-dioxa-13-azapentacyclo[10.7.1.02,10.03,7.016,20]icosa-1(19),2(10),3(7),8,16(20),17-hexaene |
| InChIKey | YSONYEIWWIFWEV-MRXNPFEDSA-N |
| SMILES | CCCN1CCC2=C3[C@H]1CC4=C(C3=CC=C2)C5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)