cas: 57022-38-5 — see every product listed under this CAS number, including other names
Carcinine 2HCl 95% (CAS 57022-38-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A173350-50mg |
| cas | 57022-38-5 |
| size | 50mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 175.69 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 754.19 Pln | |
| Ambeed | 5g | 1916.75 Pln | |
| Ambeed | 10g | 3134.94 Pln | |
| Ambeed | 25g | 5615.81 Pln | |
| Ambeed | 100g | 15322.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A173350 |
3-amino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide;dihydrochloride (CAS 57022-38-5) is a chemical compound with the molecular formula C8H16Cl2N4O and a molecular weight of 255.14 g/mol. IUPAC name: 3-amino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide;dihydrochloride. InChIKey: ZQTUNIWBUQUKAM-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N4O |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 3-amino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide;dihydrochloride |
| InChIKey | ZQTUNIWBUQUKAM-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CCNC(=O)CCN.Cl.Cl |
Computed by PubChem (NCBI)