CAS 57022-38-5 appears in our catalog under these names: Carcinine dihydrochloride, Decarboxy carnosine hydrochloride, Carcinine DiHCl, Carcinine dihydrochloride, Carcinine 2HCl 95%. Offered by: GLPBio, Chemat Brand, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, on request, 10mg, 100mg, 50mg, 250mg, 1g, 5g.
3-amino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide;dihydrochloride (CAS 57022-38-5) is a chemical compound with the molecular formula C8H16Cl2N4O and a molecular weight of 255.14 g/mol. IUPAC name: 3-amino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide;dihydrochloride. InChIKey: ZQTUNIWBUQUKAM-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N4O |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 3-amino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide;dihydrochloride |
| InChIKey | ZQTUNIWBUQUKAM-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CCNC(=O)CCN.Cl.Cl |
Computed by PubChem (NCBI)