CAS 2094444-43-4 is the registry number for 4-(1-Methyl-1H-1,2,4-triazol-5-yl)piperidin-4-ol dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(2-methyl-1,2,4-triazol-3-yl)piperidin-4-ol;dihydrochloride (CAS 2094444-43-4) is a chemical compound with the molecular formula C8H16Cl2N4O and a molecular weight of 255.14 g/mol. IUPAC name: 4-(2-methyl-1,2,4-triazol-3-yl)piperidin-4-ol;dihydrochloride. InChIKey: NCIQHRCSRWXBRV-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N4O |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 4-(2-methyl-1,2,4-triazol-3-yl)piperidin-4-ol;dihydrochloride |
| InChIKey | NCIQHRCSRWXBRV-UHFFFAOYSA-N |
| SMILES | CN1C(=NC=N1)C2(CCNCC2)O.Cl.Cl |
Computed by PubChem (NCBI)