CAS 1049741-55-0 appears in our catalog under these names: Cardiogenol C, Hydrochloride, Cardiogenol C hydrochloride/ 99.92% (existing batch purity), Cardiogenol C hydrochloride, 2-((2-((4-methoxyphenyl)amino)pyrimidin-4-yl)amino)ethanol hydrochloride, 98%, 98%, Cardiogenol C (hydrochloride), 99.79%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso), 10 mg.
2-[[2-(4-methoxyanilino)pyrimidin-4-yl]amino]ethanol;hydrochloride (CAS 1049741-55-0) is a chemical compound with the molecular formula C13H17ClN4O2 and a molecular weight of 296.75 g/mol. IUPAC name: 2-[[2-(4-methoxyanilino)pyrimidin-4-yl]amino]ethanol;hydrochloride. InChIKey: QQAHYSZVJLHCNA-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN4O2 |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | 2-[[2-(4-methoxyanilino)pyrimidin-4-yl]amino]ethanol;hydrochloride |
| InChIKey | QQAHYSZVJLHCNA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=NC=CC(=N2)NCCO.Cl |
Computed by PubChem (NCBI)