cas: 2389-60-8 — see every product listed under this CAS number, including other names
Cbz-Lys(Boc)-OH, 99.97% (CAS 2389-60-8) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 50 g, 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009033-10 g |
| cas | 2389-60-8 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 477.59 Pln | |
| MedChemExpress | 5 g | 342.91 Pln | |
| MedChemExpress | 50 g | 1257.78 Pln | |
| MedChemExpress | 100 g | 1945.09 Pln | |
| MedChemExpress | 25 g | 830.53 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.97% |
(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 2389-60-8) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: DYSBKEOCHROEGX-HNNXBMFYSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DYSBKEOCHROEGX-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)