cas: 2389-60-8 — see every product listed under this CAS number, including other names
Z-Lys(Boc)-OH, 98% (CAS 2389-60-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03058-1G |
| cas | 2389-60-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 100g | 794.53 Pln | |
| Fluorochem | 500g | 3757.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 2389-60-8) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: DYSBKEOCHROEGX-HNNXBMFYSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DYSBKEOCHROEGX-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)