cas: 1334177-88-6 — see every product listed under this CAS number, including other names
Cbz-NH-PEG12-C2-acid 95% (CAS 1334177-88-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1639246-50mg |
| cas | 1334177-88-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 520.56 Pln | |
| Ambeed | 100mg | 887.69 Pln | |
| Ambeed | 250mg | 1672.00 Pln | |
| Ambeed | 1g | 4558.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1639246 |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334177-88-6) is a chemical compound with the molecular formula C35H61NO16 and a molecular weight of 751.9 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: WVKANAHNXOWXKU-UHFFFAOYSA-N.
| Molecular formula | C35H61NO16 |
|---|---|
| Molecular weight | 751.9 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | WVKANAHNXOWXKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)