cas: 2790-84-3 — see every product listed under this CAS number, including other names
Cbz-Val-Gly-OH 98% (CAS 2790-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A335141-100g |
| cas | 2790-84-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 2862.38 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 25g | 837.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A335141 |
2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid (CAS 2790-84-3) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: 2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid. InChIKey: MWOJWUBBCZRMTB-ZDUSSCGKSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid |
| InChIKey | MWOJWUBBCZRMTB-ZDUSSCGKSA-N |
| SMILES | CC(C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)