Products 2916371-54-3
CAS 2916371-54-3 appears in our catalog under these names: Cisd2 agonist 1/ min. 98%, Cisd2 agonist 1, Cisd2 agonist 1 99%, Cisd2 agonist 1, Cisd2 agonist 1, 99.22%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
Methyl 2-amino-5-[(4-fluorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate (CAS 2916371-54-3) is a chemical compound with the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. IUPAC name: methyl 2-amino-5-[(4-fluorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate. InChIKey: QRCRHHUPIOWOOO-UHFFFAOYSA-N.
| Molecular formula | C14H13FN2O3S |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | methyl 2-amino-5-[(4-fluorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| InChIKey | QRCRHHUPIOWOOO-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)OC)N)C(=O)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)