cas: 59767-24-7 — see every product listed under this CAS number, including other names
Clemastine Fumarate Impurity C 97% (CAS 59767-24-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A247700-1mg |
| cas | 59767-24-7 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 698.56 Pln | |
| Ambeed | 100g | 1955.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A247700 |
1-(4-chlorophenyl)-1-phenylethanol (CAS 59767-24-7) is a chemical compound with the molecular formula C14H13ClO and a molecular weight of 232.70 g/mol. IUPAC name: 1-(4-chlorophenyl)-1-phenylethanol. InChIKey: MHJLXHJZQCHSIT-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO |
|---|---|
| Molecular weight | 232.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-1-phenylethanol |
| InChIKey | MHJLXHJZQCHSIT-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)