CAS 13389-74-7 appears in our catalog under these names: (4-Chlorophenyl)(4-methylphenyl)methanol, 98%, 4-Chloro-α-(4-methylphenyl)benzenemethanol, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
(4-chlorophenyl)-(4-methylphenyl)methanol (CAS 13389-74-7) is a chemical compound with the molecular formula C14H13ClO and a molecular weight of 232.70 g/mol. IUPAC name: (4-chlorophenyl)-(4-methylphenyl)methanol. InChIKey: CYLLIAPEJJBIRK-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO |
|---|---|
| Molecular weight | 232.70 g/mol |
| IUPAC name | (4-chlorophenyl)-(4-methylphenyl)methanol |
| InChIKey | CYLLIAPEJJBIRK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)