CAS 20498-65-1 appears in our catalog under these names: 1–(3–Chlorophenyl)–2–phenylethan–1–ol, 1-(3-Chlorophenyl)-2-phenylethan-1-ol, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
1-(3-chlorophenyl)-2-phenylethanol (CAS 20498-65-1) is a chemical compound with the molecular formula C14H13ClO and a molecular weight of 232.70 g/mol. IUPAC name: 1-(3-chlorophenyl)-2-phenylethanol. InChIKey: BLTASTNTJCYLHR-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO |
|---|---|
| Molecular weight | 232.70 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2-phenylethanol |
| InChIKey | BLTASTNTJCYLHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)