cas: 1319197-71-1 — see every product listed under this CAS number, including other names
Clopidogrel 95% (CAS 1319197-71-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2432793-1mg |
| cas | 1319197-71-1 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 809.81 Pln | |
| Ambeed | 5mg | 1410.56 Pln | |
| Ambeed | 10mg | 2100.31 Pln | |
| Ambeed | 25mg | 3485.38 Pln | |
| Ambeed | 50mg | 4920.50 Pln | |
| Ambeed | 100mg | 6533.62 Pln | |
| Ambeed | 250mg | 9409.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2432793 |
Methyl (2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetate (CAS 1319197-71-1) is a chemical compound with the molecular formula C16H16ClNO3S and a molecular weight of 337.8 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetate. InChIKey: GYAQMDGEXWMAFB-BUSXIPJBSA-N.
| Molecular formula | C16H16ClNO3S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetate |
| InChIKey | GYAQMDGEXWMAFB-BUSXIPJBSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)[N+]2(CCC3=C(C2)C=CS3)[O-] |
Computed by PubChem (NCBI)