Products 212842-64-3
CAS 212842-64-3 appears in our catalog under these names: Cowaxanthone B/ 99.81% (existing batch purity), Cowaxanthone B, Cowaxanthone B, 98.05%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
1,3-dihydroxy-6,7-dimethoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one (CAS 212842-64-3) is a chemical compound with the molecular formula C25H28O6 and a molecular weight of 424.5 g/mol. IUPAC name: 1,3-dihydroxy-6,7-dimethoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one. InChIKey: BLZDSTHKFQEOIU-UHFFFAOYSA-N.
| Molecular formula | C25H28O6 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | 1,3-dihydroxy-6,7-dimethoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | BLZDSTHKFQEOIU-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C2=C(C=C1O)OC3=CC(=C(C(=C3C2=O)CC=C(C)C)OC)OC)O)C |
Computed by PubChem (NCBI)