Products 120551-59-9
CAS 120551-59-9 appears in our catalog under these names: Crilvastatin/ 98.47% (existing batch purity), Crilvastatin. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
(3,3,5-trimethylcyclohexyl) (2S)-5-oxopyrrolidine-2-carboxylate (CAS 120551-59-9) is a chemical compound with the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. IUPAC name: (3,3,5-trimethylcyclohexyl) (2S)-5-oxopyrrolidine-2-carboxylate. InChIKey: FXAAOALUHHXBSO-ILDUYXDCSA-N.
| Molecular formula | C14H23NO3 |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | (3,3,5-trimethylcyclohexyl) (2S)-5-oxopyrrolidine-2-carboxylate |
| InChIKey | FXAAOALUHHXBSO-ILDUYXDCSA-N |
| SMILES | CC1CC(CC(C1)(C)C)OC(=O)[C@@H]2CCC(=O)N2 |
Computed by PubChem (NCBI)