CAS 1000852-17-4 appears in our catalog under these names: Crolibulin/ 98.19% (existing batch purity), Crolibulin, Crolibulin, 98.96%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 25 mg.
(4R)-2,7,8-triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4H-chromene-3-carbonitrile (CAS 1000852-17-4) is a chemical compound with the molecular formula C18H17BrN4O3 and a molecular weight of 417.3 g/mol. IUPAC name: (4R)-2,7,8-triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4H-chromene-3-carbonitrile. InChIKey: JXONINOYTKKXQQ-CQSZACIVSA-N.
| Molecular formula | C18H17BrN4O3 |
|---|---|
| Molecular weight | 417.3 g/mol |
| IUPAC name | (4R)-2,7,8-triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4H-chromene-3-carbonitrile |
| InChIKey | JXONINOYTKKXQQ-CQSZACIVSA-N |
| SMILES | COC1=C(C(=CC(=C1)[C@@H]2C3=C(C(=C(C=C3)N)N)OC(=C2C#N)N)Br)OC |
Computed by PubChem (NCBI)