cas: 527-31-1 — see every product listed under this CAS number, including other names
Cyclohexane-1,2,3,4,5,6-hexaone, 95% (contains 40-44%Water), 95% (contains 40-44%Water) (CAS 527-31-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 50g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114P5I-1g |
| cas | 527-31-1 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 294.80 Pln | |
| Chemat | 100g | 813.20 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 500g | 3816.00 Pln | |
| Chemat | 1kg | 6078.80 Pln |
| purity | 95% (contains 40-44%Water) |
|---|---|
| delivery time | 3 weeks |
Cyclohexane-1,2,3,4,5,6-hexone (CAS 527-31-1) is a chemical compound with the molecular formula C6O6 and a molecular weight of 168.06 g/mol. IUPAC name: cyclohexane-1,2,3,4,5,6-hexone. InChIKey: PKRGYJHUXHCUCN-UHFFFAOYSA-N.
| Molecular formula | C6O6 |
|---|---|
| Molecular weight | 168.06 g/mol |
| IUPAC name | cyclohexane-1,2,3,4,5,6-hexone |
| InChIKey | PKRGYJHUXHCUCN-UHFFFAOYSA-N |
| SMILES | C1(=O)C(=O)C(=O)C(=O)C(=O)C1=O |
Computed by PubChem (NCBI)