cas: 527-31-1 — see every product listed under this CAS number, including other names
Cyclohexane-1,2,3,4,5,6-hexaone, 98% (CAS 527-31-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F615115-5G |
| cas | 527-31-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 25g | 445.69 Pln | |
| Fluorochem | 100g | 1122.54 Pln | |
| Fluorochem | 500g | 5371.04 Pln | |
| Fluorochem | 1kg | 9775.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Cyclohexane-1,2,3,4,5,6-hexone (CAS 527-31-1) is a chemical compound with the molecular formula C6O6 and a molecular weight of 168.06 g/mol. IUPAC name: cyclohexane-1,2,3,4,5,6-hexone. InChIKey: PKRGYJHUXHCUCN-UHFFFAOYSA-N.
| Molecular formula | C6O6 |
|---|---|
| Molecular weight | 168.06 g/mol |
| IUPAC name | cyclohexane-1,2,3,4,5,6-hexone |
| InChIKey | PKRGYJHUXHCUCN-UHFFFAOYSA-N |
| SMILES | C1(=O)C(=O)C(=O)C(=O)C(=O)C1=O |
Computed by PubChem (NCBI)