cas: 527-31-1 — see every product listed under this CAS number, including other names
Triquinoyl, >95.0%(T) (CAS 527-31-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0876-1G |
| cas | 527-31-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 177.35 Pln | |
| TCI | 5g | 521.56 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
Cyclohexane-1,2,3,4,5,6-hexone (CAS 527-31-1) is a chemical compound with the molecular formula C6O6 and a molecular weight of 168.06 g/mol. IUPAC name: cyclohexane-1,2,3,4,5,6-hexone. InChIKey: PKRGYJHUXHCUCN-UHFFFAOYSA-N.
| Molecular formula | C6O6 |
|---|---|
| Molecular weight | 168.06 g/mol |
| IUPAC name | cyclohexane-1,2,3,4,5,6-hexone |
| InChIKey | PKRGYJHUXHCUCN-UHFFFAOYSA-N |
| SMILES | C1(=O)C(=O)C(=O)C(=O)C(=O)C1=O |
Computed by PubChem (NCBI)