cas: 58271-62-8 — see every product listed under this CAS number, including other names
Cyclohexyl(phenyl)methanamine hydrochloride, 95% (CAS 58271-62-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A646869-250mg |
| cas | 58271-62-8 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 428.05 Pln | |
| AmBeed | 100mg | 284.83 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Cyclohexyl(phenyl)methanamine;hydrochloride (CAS 58271-62-8) is a chemical compound with the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. IUPAC name: cyclohexyl(phenyl)methanamine;hydrochloride. InChIKey: INIQGHHKHOQSIT-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN |
|---|---|
| Molecular weight | 225.76 g/mol |
| IUPAC name | cyclohexyl(phenyl)methanamine;hydrochloride |
| InChIKey | INIQGHHKHOQSIT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)