cas: 58271-62-8 — see every product listed under this CAS number, including other names
cyclohexyl(phenyl)methanamine hydrochloride, 98%, 98% (CAS 58271-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120NB0-100mg |
| cas | 58271-62-8 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 222.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Cyclohexyl(phenyl)methanamine;hydrochloride (CAS 58271-62-8) is a chemical compound with the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. IUPAC name: cyclohexyl(phenyl)methanamine;hydrochloride. InChIKey: INIQGHHKHOQSIT-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN |
|---|---|
| Molecular weight | 225.76 g/mol |
| IUPAC name | cyclohexyl(phenyl)methanamine;hydrochloride |
| InChIKey | INIQGHHKHOQSIT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)