cas: 1257213-52-7 — see every product listed under this CAS number, including other names
Cyclopropanecarboxylic acid, 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-, ethyl ester, 95%, 95% (CAS 1257213-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OJA-100mg |
| cas | 1257213-52-7 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 520.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate (CAS 1257213-52-7) is a chemical compound with the molecular formula C18H25BO4 and a molecular weight of 316.2 g/mol. IUPAC name: ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate. InChIKey: ZYSWTQGHMDIKPH-UHFFFAOYSA-N.
| Molecular formula | C18H25BO4 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate |
| InChIKey | ZYSWTQGHMDIKPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CC3)C(=O)OCC |
Computed by PubChem (NCBI)