cas: 1257213-52-7 — see every product listed under this CAS number, including other names
Ethyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanecarboxylate 95% (CAS 1257213-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A366373-100mg |
| cas | 1257213-52-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 648.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A366373 |
Ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate (CAS 1257213-52-7) is a chemical compound with the molecular formula C18H25BO4 and a molecular weight of 316.2 g/mol. IUPAC name: ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate. InChIKey: ZYSWTQGHMDIKPH-UHFFFAOYSA-N.
| Molecular formula | C18H25BO4 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate |
| InChIKey | ZYSWTQGHMDIKPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CC3)C(=O)OCC |
Computed by PubChem (NCBI)