D(+)-10-Camphorsulfonyl chloride, 97%
cas: 21286-54-4 — see every product listed under this CAS number, including other names
D(+)-10-Camphorsulfonyl chloride, 97% (CAS 21286-54-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212016-1G |
| cas | 21286-54-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 435.28 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride (CAS 21286-54-4) is a chemical compound with the molecular formula C10H15ClO3S and a molecular weight of 250.74 g/mol. IUPAC name: [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride. InChIKey: BGABKEVTHIJBIW-GMSGAONNSA-N.
| Molecular formula | C10H15ClO3S |
|---|---|
| Molecular weight | 250.74 g/mol |
| IUPAC name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride |
| InChIKey | BGABKEVTHIJBIW-GMSGAONNSA-N |
| SMILES | CC1([C@@H]2CC[C@]1(C(=O)C2)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)
Synonyms:
Camphor-10-sulfonyl chloride, D(+)-10-Camphorsulfonyl chloride, ((1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonyl chloride, (1S)-(+)-Camphor-10-sulfonyl chloride, (1S)-(+)-10-Camphorsulfonyl chloride, [(1S,4R)-7,7-Dimethyl-2-Oxobicyclo[2.2.1]Heptan-1-Yl]Methanesulfonyl Chloride, D-10-Camphorsulfonyl chloride, C10H15ClO3S, (1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonyl chloride, (+)-Camphor-10-sulfonyl chloride