CAS 4552-50-5 appears in our catalog under these names: (7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride, 95%, (7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonyl chloride, 98+%, DL-10-Camphorsulfonyl Chloride. Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 100g, 5g, 25g, 1g, on request, 10g.
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride (CAS 4552-50-5) is a chemical compound with the molecular formula C10H15ClO3S and a molecular weight of 250.74 g/mol. IUPAC name: (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride. InChIKey: BGABKEVTHIJBIW-UHFFFAOYSA-N.
| Molecular formula | C10H15ClO3S |
|---|---|
| Molecular weight | 250.74 g/mol |
| IUPAC name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride |
| InChIKey | BGABKEVTHIJBIW-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(=O)C2)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)