CAS 21286-54-4 appears in our catalog under these names: D(+)-10-Camphorsulfonyl chloride, 98%, (1S)-(+)-10-Camphorsulfonyl Chloride, (1S)–(+)–10–Camphorsulfonyl chloride, (+)-10-Camphorsulfonyl Chloride, >97.0%(GC)(T), ((1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonyl chloride 90%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 20g, 2g, 1g.
[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride (CAS 21286-54-4) is a chemical compound with the molecular formula C10H15ClO3S and a molecular weight of 250.74 g/mol. IUPAC name: [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride. InChIKey: BGABKEVTHIJBIW-GMSGAONNSA-N.
| Molecular formula | C10H15ClO3S |
|---|---|
| Molecular weight | 250.74 g/mol |
| IUPAC name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride |
| InChIKey | BGABKEVTHIJBIW-GMSGAONNSA-N |
| SMILES | CC1([C@@H]2CC[C@]1(C(=O)C2)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)