cas: 90-80-2 — see every product listed under this CAS number, including other names
D-(+)-Glucono-1,5-lactone, 98.0% (CAS 90-80-2) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 25 g, 5 g, 50 g, 1 kg, 10 g, 100 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-I0301-10mM/1mL |
| cas | 90-80-2 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 25 g | 352.20 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 50 g | 421.86 Pln | |
| MedChemExpress | 1 kg | 914.12 Pln | |
| MedChemExpress | 10 g | 273.25 Pln | |
| MedChemExpress | 100 g | 505.45 Pln | |
| MedChemExpress | 500 g | 751.58 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.0% |
D-glucono-1,5-lactone is an aldono-1,5-lactone obtained from D-gluconic acid. It has a role as an animal metabolite and a mouse metabolite. It is a gluconolactone and an aldono-1,5-lactone. It is functionally related to a D-gluconic acid.
Source: ChEBI
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | (3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one |
| InChIKey | PHOQVHQSTUBQQK-SQOUGZDYSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(=O)O1)O)O)O)O |
Computed by PubChem (NCBI)