Products 161168-87-2
CAS 161168-87-2 appears in our catalog under these names: D-Idonic acid-1,4-lactone, 95%, D-Idonic Acid-1,4-Lactone. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth. Available pack sizes: 100mg, 250mg, on request.
(3S,4S,5R)-5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one (CAS 161168-87-2) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: (3S,4S,5R)-5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one. InChIKey: SXZYCXMUPBBULW-VRUJNKQUSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | (3S,4S,5R)-5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one |
| InChIKey | SXZYCXMUPBBULW-VRUJNKQUSA-N |
| SMILES | C(C([C@@H]1[C@H]([C@@H](C(=O)O1)O)O)O)O |
Computed by PubChem (NCBI)