CAS 608-68-4 appears in our catalog under these names: (+)-Dimethyl L-tartrate, 97%, Dimethyl L–(+)–Tartrate, (+)-Dimethyl L-tartrate/ 98+%, Dimethyl L-(+)-tartrate, Dimethyl L-(+)-Tartrate, >98.0%(GC). Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, TCI. Available pack sizes: 25g, 500g, 100g, 5g, 0,25kg, 1kg, 1000g.
Dimethyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 608-68-4) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: dimethyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: PVRATXCXJDHJJN-QWWZWVQMSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | dimethyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | PVRATXCXJDHJJN-QWWZWVQMSA-N |
| SMILES | COC(=O)[C@@H]([C@H](C(=O)OC)O)O |
Computed by PubChem (NCBI)