D-1-Fmoc-Nipecotic acid, 98%
cas: 193693-67-3 — see every product listed under this CAS number, including other names
D-1-Fmoc-Nipecotic acid, 98% (CAS 193693-67-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034413-250MG |
| cas | 193693-67-3 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 500mg | 320.74 Pln | |
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 2.5g | 758.08 Pln | |
| Fluorochem | 5g | 1257.91 Pln | |
| Fluorochem | 10g | 2158.63 Pln | |
| Fluorochem | 25g | 4256.85 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid (CAS 193693-67-3) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid. InChIKey: FINXGQXNIBNREL-CQSZACIVSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
| InChIKey | FINXGQXNIBNREL-CQSZACIVSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidine-3-carboxylic acid, (r)-1-fmoc-piperidine-3-carboxylic acid, (R)-1-(((9H-fluoren-9-yl)methoxy)carbonyl)piperidine-3-carboxylic acid, D-1-Fmoc-Nipecotic acid, (R)-Fmoc-Nip-OH, fmoc-(r)-nipecotic acid, (3R)-1-Fmoc-3-piperidinecarboxylic acid, (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid, FMOC-D-NIP-OH, fmoc-d-nipc-oh