CAS 193693-68-4 appears in our catalog under these names: (S)–1–(((9H–Fluoren–9–yl)methoxy)carbonyl)piperidine–3–carboxylic acid, Fmoc-L-Nip-OH, Fmoc-L-Nip-OH 98%, (S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidine-3-carboxylic acid, 98%, 98%, L-1-Fmoc-Nipecotic acid, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g.
(3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid (CAS 193693-68-4) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid. InChIKey: FINXGQXNIBNREL-AWEZNQCLSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
| InChIKey | FINXGQXNIBNREL-AWEZNQCLSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)