cas: 72002-30-3 — see every product listed under this CAS number, including other names
D-6-Oxo-pipecolinic acid 98% (CAS 72002-30-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A683074-100mg |
| cas | 72002-30-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1277.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A683074 |
(2R)-6-oxopiperidine-2-carboxylic acid (CAS 72002-30-3) is a chemical compound with the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. IUPAC name: (2R)-6-oxopiperidine-2-carboxylic acid. InChIKey: FZXCPFJMYOQZCA-SCSAIBSYSA-N.
| Molecular formula | C6H9NO3 |
|---|---|
| Molecular weight | 143.14 g/mol |
| IUPAC name | (2R)-6-oxopiperidine-2-carboxylic acid |
| InChIKey | FZXCPFJMYOQZCA-SCSAIBSYSA-N |
| SMILES | C1C[C@@H](NC(=O)C1)C(=O)O |
Computed by PubChem (NCBI)