cas: 87494-13-1 — see every product listed under this CAS number, including other names
D-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-(triphenylmethyl)-, 98%, 98% (CAS 87494-13-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OGG-250mg |
| cas | 87494-13-1 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 50g | 184.40 Pln | |
| Chemat | 100g | 290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid (CAS 87494-13-1) is a chemical compound with the molecular formula C27H29NO4S and a molecular weight of 463.6 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid. InChIKey: JDTOWOURWBDELG-HSZRJFAPSA-N.
| Molecular formula | C27H29NO4S |
|---|---|
| Molecular weight | 463.6 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid |
| InChIKey | JDTOWOURWBDELG-HSZRJFAPSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)