cas: 87494-13-1 — see every product listed under this CAS number, including other names
Boc-D-Cys(Trt)-OH, 95% (CAS 87494-13-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045430-5G |
| cas | 87494-13-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 174.96 Pln | |
| Fluorochem | 100g | 450.90 Pln | |
| Fluorochem | 500g | 1893.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid (CAS 87494-13-1) is a chemical compound with the molecular formula C27H29NO4S and a molecular weight of 463.6 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid. InChIKey: JDTOWOURWBDELG-HSZRJFAPSA-N.
| Molecular formula | C27H29NO4S |
|---|---|
| Molecular weight | 463.6 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid |
| InChIKey | JDTOWOURWBDELG-HSZRJFAPSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)