cas: 30688-66-5 — see every product listed under this CAS number, including other names
D-GLUCOSE, 4,6-O-(PHENYLMETHYLENE)-, 95%, 95% (CAS 30688-66-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1141TA-1g |
| cas | 30688-66-5 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 50g | 818.00 Pln | |
| Chemat | 100g | 1302.80 Pln | |
| Chemat | 250g | 2680.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propanal (CAS 30688-66-5) is a chemical compound with the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propanal. InChIKey: XTVRQMKOKFFGDZ-ZLUZDFLPSA-N.
| Molecular formula | C13H16O6 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propanal |
| InChIKey | XTVRQMKOKFFGDZ-ZLUZDFLPSA-N |
| SMILES | C1[C@H]([C@@H](OC(O1)C2=CC=CC=C2)[C@@H]([C@H](C=O)O)O)O |
Computed by PubChem (NCBI)