cas: 28607-46-7 — see every product listed under this CAS number, including other names
D-Phenylalanine Benzyl Ester p-Toluenesulfonate, >98.0%(HPLC)(T) (CAS 28607-46-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P1722-5G |
| cas | 28607-46-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 157.68 Pln | |
| TCI | 25g | 511.73 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Benzyl (2R)-2-amino-3-phenylpropanoate;4-methylbenzenesulfonic acid (CAS 28607-46-7) is a chemical compound with the molecular formula C23H25NO5S and a molecular weight of 427.5 g/mol. IUPAC name: benzyl (2R)-2-amino-3-phenylpropanoate;4-methylbenzenesulfonic acid. InChIKey: ZLZGBBIPWXUQST-XFULWGLBSA-N.
| Molecular formula | C23H25NO5S |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | benzyl (2R)-2-amino-3-phenylpropanoate;4-methylbenzenesulfonic acid |
| InChIKey | ZLZGBBIPWXUQST-XFULWGLBSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)C[C@H](C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)