Products 345288-49-5
CAS 345288-49-5 appears in our catalog under these names: endo CNTinh–03, endo CNTinh-03, 99.96%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 5 mg, 50 mg, 10 mg, 100 mg, 10mM/1mL.
3-[[3-methoxycarbonyl-5-methyl-4-(4-methylphenyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (CAS 345288-49-5) is a chemical compound with the molecular formula C23H25NO5S and a molecular weight of 427.5 g/mol. IUPAC name: 3-[[3-methoxycarbonyl-5-methyl-4-(4-methylphenyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: MGMHBWAUAKEYAO-UHFFFAOYSA-N.
| Molecular formula | C23H25NO5S |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 3-[[3-methoxycarbonyl-5-methyl-4-(4-methylphenyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | MGMHBWAUAKEYAO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(SC(=C2C(=O)OC)NC(=O)C3C4CCC(C4)C3C(=O)O)C |
Computed by PubChem (NCBI)