CAS 1738-78-9 appears in our catalog under these names: L-Phenylalanine benzyl ester p-toluenesulfonate, 97%, H–Phe–OBzl · p–tosylate, H-L-Phe-OBzl*Tos, Benzyl L-Phenylalaninate 4-Methylbenzenesulfonate, >98.0%(HPLC)(T), H-Phe-OBzl.TosOH, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Chemat. Available pack sizes: 100g, 1kg, 25g, 5g, 500g.
Benzyl (2S)-2-amino-3-phenylpropanoate;4-methylbenzenesulfonic acid (CAS 1738-78-9) is a chemical compound with the molecular formula C23H25NO5S and a molecular weight of 427.5 g/mol. IUPAC name: benzyl (2S)-2-amino-3-phenylpropanoate;4-methylbenzenesulfonic acid. InChIKey: ZLZGBBIPWXUQST-RSAXXLAASA-N.
| Molecular formula | C23H25NO5S |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-phenylpropanoate;4-methylbenzenesulfonic acid |
| InChIKey | ZLZGBBIPWXUQST-RSAXXLAASA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)C[C@@H](C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)