D-Saccharic acid 1,4-lactone hydrate 95%
cas: 61278-30-6 — see every product listed under this CAS number, including other names
D-Saccharic acid 1,4-lactone hydrate 95% (CAS 61278-30-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A269122-50mg |
| cas | 61278-30-6 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 236.88 Pln | |
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1377.19 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A269122 |
(2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate (CAS 61278-30-6) is a chemical compound with the molecular formula C6H10O8 and a molecular weight of 210.14 g/mol. IUPAC name: (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate. InChIKey: NPFKVZHSFSFLPU-QGBSHYGGSA-N.
| Molecular formula | C6H10O8 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate |
| InChIKey | NPFKVZHSFSFLPU-QGBSHYGGSA-N |
| SMILES | [C@H]1([C@H](C(=O)O[C@@H]1[C@@H](C(=O)O)O)O)O.O |
Computed by PubChem (NCBI)
Synonyms:
Npc488547, D-Saccharic acid 1,4-lactone monohydrate, d-glucaro-1,4-lactone monohydrate, D-Saccharic acid 1,4-lactone (hydrate), D-Saccharolactone, D-Glucaric acid-1,4-lactone, orb1303116, (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid hydrate, (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate, D-Glucaric acid, 1,4-lactone hydrate