CAS 1155877-97-6 appears in our catalog under these names: D159687/ 95.02% (existing batch purity), D-159687 - Bio-X â„¢, D-159687, 1-(4-((3'-Chloro-6-methoxy-[1,1'-biphenyl]-3-yl)methyl)phenyl)urea, 98%, 98%, D159687, 98.34%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Roth. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg.
[4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]urea (CAS 1155877-97-6) is a chemical compound with the molecular formula C21H19ClN2O2 and a molecular weight of 366.8 g/mol. IUPAC name: [4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]urea. InChIKey: RJJLUTWHJUDZFP-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN2O2 |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | [4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]urea |
| InChIKey | RJJLUTWHJUDZFP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC2=CC=C(C=C2)NC(=O)N)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)