Products 898532-85-9

CAS 898532-85-9 is the registry number for D3/5-HT receptor modulator-1, 99.75%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg.

Structural formula: {0} (CAS {1})

N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1-benzofuran-2-carboxamide (CAS 898532-85-9) is a chemical compound with the molecular formula C24H29N3O2 and a molecular weight of 391.5 g/mol. IUPAC name: N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1-benzofuran-2-carboxamide. InChIKey: DIJKUIXRAWOVGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC24H29N3O2
Molecular weight391.5 g/mol
IUPAC nameN-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1-benzofuran-2-carboxamide
InChIKeyDIJKUIXRAWOVGJ-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)N2CCN(CC2)CCCCNC(=O)C3=CC4=CC=CC=C4O3

Computed by PubChem (NCBI)