Products 2714436-92-5
CAS 2714436-92-5 appears in our catalog under these names: Bromacil D3 (methyl D3) 100 µg/mL in Acetonitrile, D3-Bromacil, D3-Bromacil, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1ml, 1x5mg, 1x1ml.
5-bromo-3-butan-2-yl-6-(trideuteriomethyl)-1H-pyrimidine-2,4-dione (CAS 2714436-92-5) is a chemical compound with the molecular formula C9H13BrN2O2 and a molecular weight of 264.13 g/mol. IUPAC name: 5-bromo-3-butan-2-yl-6-(trideuteriomethyl)-1H-pyrimidine-2,4-dione. InChIKey: CTSLUCNDVMMDHG-HPRDVNIFSA-N.
| Molecular formula | C9H13BrN2O2 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 5-bromo-3-butan-2-yl-6-(trideuteriomethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | CTSLUCNDVMMDHG-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=O)N(C(=O)N1)C(C)CC)Br |
Computed by PubChem (NCBI)