Products 75352-01-1
CAS 75352-01-1 appears in our catalog under these names: alfa-Pinene-d3, alpha-Pinene-D3, D3-alpha-Pinene, Concentration: 100 µg/ml Solvent: Cyclohexane. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 100mg, 1x1ml.
6,6-dimethyl-2-(trideuteriomethyl)bicyclo[3.1.1]hept-2-ene (CAS 75352-01-1) is a chemical compound with the molecular formula C10H16 and a molecular weight of 139.25 g/mol. IUPAC name: 6,6-dimethyl-2-(trideuteriomethyl)bicyclo[3.1.1]hept-2-ene. InChIKey: GRWFGVWFFZKLTI-FIBGUPNXSA-N.
| Molecular formula | C10H16 |
|---|---|
| Molecular weight | 139.25 g/mol |
| IUPAC name | 6,6-dimethyl-2-(trideuteriomethyl)bicyclo[3.1.1]hept-2-ene |
| InChIKey | GRWFGVWFFZKLTI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CCC2CC1C2(C)C |
Computed by PubChem (NCBI)