Products 1675245-09-6
CAS 1675245-09-6 appears in our catalog under these names: DAC-2-25/ 99.78% (existing batch purity), DAC–2–25, DAC-2-25. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 5 mg.
6-[4-(dimethylamino)phenyl]-4-methyl-1H-pyridin-2-one (CAS 1675245-09-6) is a chemical compound with the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. IUPAC name: 6-[4-(dimethylamino)phenyl]-4-methyl-1H-pyridin-2-one. InChIKey: LDASRACNPJVHBD-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 6-[4-(dimethylamino)phenyl]-4-methyl-1H-pyridin-2-one |
| InChIKey | LDASRACNPJVHBD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC(=C1)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)