DBCO-C5-Amine, 97%
cas: 2401876-29-5 — see every product listed under this CAS number, including other names
DBCO-C5-Amine, 97% (CAS 2401876-29-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1495404-10mg |
| cas | 2401876-29-5 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 820.94 Pln | |
| Ambeed | 25mg | 1672.00 Pln | |
| Ambeed | 50mg | 2734.44 Pln | |
| Ambeed | 100mg | 4342.00 Pln | |
| Ambeed | 250mg | 7696.19 Pln | |
| BLDpharm | 10mg | 880.83 Pln | |
| BLDpharm | 25mg | 1797.17 Pln | |
| BLDpharm | 50mg | 2946.76 Pln | |
| BLDpharm | 100mg | 4673.93 Pln | |
| BLDpharm | 250mg | 8289.33 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)pentan-1-one (CAS 2401876-29-5) is a chemical compound with the molecular formula C20H20N2O and a molecular weight of 304.4 g/mol. IUPAC name: 5-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)pentan-1-one. InChIKey: LOQDFUBKPINLEO-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 5-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)pentan-1-one |
| InChIKey | LOQDFUBKPINLEO-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCCCN |
Computed by PubChem (NCBI)