CAS 165190-76-1 appears in our catalog under these names: 4,7–Di(2–thienyl)–2,1,3–benzothiadiazole, DBT/ 99.64% (existing batch purity), 4,7-Di(2-thienyl)-2,1,3-benzothiadiazole, >98.0%(HPLC)(N), DTBT 98%, 2,1,3-Benzothiadiazole, 4,7-di-2-thienyl-, 98%, 98%. Offered by: GLPBio, TargetMol, TCI, Ambeed, Chemat. Available pack sizes: 1g, 200mg, 5g, 100mg, 10g, 250mg, 500 mg, 100 mg.
4,7-dithiophen-2-yl-2,1,3-benzothiadiazole (CAS 165190-76-1) is a chemical compound with the molecular formula C14H8N2S3 and a molecular weight of 300.4 g/mol. IUPAC name: 4,7-dithiophen-2-yl-2,1,3-benzothiadiazole. InChIKey: XGERJWSXTKVPSV-UHFFFAOYSA-N.
| Molecular formula | C14H8N2S3 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 4,7-dithiophen-2-yl-2,1,3-benzothiadiazole |
| InChIKey | XGERJWSXTKVPSV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C3=NSN=C23)C4=CC=CS4 |
Computed by PubChem (NCBI)