Products 303141-21-1
CAS 303141-21-1 appears in our catalog under these names: DC-S239/ 99.36% (existing batch purity), DC–S239, DC-S239, DC-S239, 99.73%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
Ethyl 2-amino-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate (CAS 303141-21-1) is a chemical compound with the molecular formula C15H15N3O5S and a molecular weight of 349.4 g/mol. IUPAC name: ethyl 2-amino-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate. InChIKey: SIVTXLSKYVOFHS-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O5S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | ethyl 2-amino-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate |
| InChIKey | SIVTXLSKYVOFHS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1C)C(=O)NC2=CC(=CC=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)