CAS 792946-69-1 appears in our catalog under these names: DCLX069/ 98.06% (existing batch purity), DCLX069, Ethyl 3-amino-4-(4-benzylpiperazin-1-yl)benzoate, 95%, 95%, DCLX069, 98.03%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
Ethyl 3-amino-4-(4-benzylpiperazin-1-yl)benzoate (CAS 792946-69-1) is a chemical compound with the molecular formula C20H25N3O2 and a molecular weight of 339.4 g/mol. IUPAC name: ethyl 3-amino-4-(4-benzylpiperazin-1-yl)benzoate. InChIKey: RITRCMIWRZBDID-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O2 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | ethyl 3-amino-4-(4-benzylpiperazin-1-yl)benzoate |
| InChIKey | RITRCMIWRZBDID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N2CCN(CC2)CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)