cas: 1326242-72-1 — see every product listed under this CAS number, including other names
DI-TERT-BUTYL 1-(BICYCLO[1.1.1]PENTAN-1-YL)HYDRAZINE-1,2-DICARBOXYLATE, 97% (CAS 1326242-72-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F530906-500MG |
| cas | 1326242-72-1 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 4126.69 Pln | |
| Fluorochem | 100mg | 1596.33 Pln | |
| Fluorochem | 250mg | 2512.67 Pln | |
| Fluorochem | 1g | 6141.61 Pln | |
| Fluorochem | 5g | 18293.58 Pln | |
| Fluorochem | 10g | 30445.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(1-bicyclo[1.1.1]pentanyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (CAS 1326242-72-1) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: tert-butyl N-(1-bicyclo[1.1.1]pentanyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate. InChIKey: FEPHQWPVQIMVGG-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | tert-butyl N-(1-bicyclo[1.1.1]pentanyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| InChIKey | FEPHQWPVQIMVGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)C12CC(C1)C2 |
Computed by PubChem (NCBI)